C26H27F2N5O4S — CID 175622730
1-carbamoyl-3-[(3,4-difluoro-5-methylphenyl)methyl]-3-[(4-methoxyanilino)methyl]-1-[(6-oxo-3,7-dihydro-2H-thieno[2,3-b]pyridin-5-yl)methyl]urea (PubChem CID 175622730) has the molecular formula C26H27F2N5O4S and a molecular weight of 543.60 g/mol. Its IUPAC name is 1-carbamoyl-3-[(3,4-difluoro-5-methylphenyl)methyl]-3-[(4-methoxyanilino)methyl]-1-[(6-oxo-3,7-dihydro-2H-thieno[2,3-b]pyridin-5-yl)methyl]urea.
| Compound Name | 1-carbamoyl-3-[(3,4-difluoro-5-methylphenyl)methyl]-3-[(4-methoxyanilino)methyl]-1-[(6-oxo-3,7-dihydro-2H-thieno[2,3-b]pyridin-5-yl)methyl]urea |
|---|---|
| PubChem CID | 175622730 |
| Molecular Formula | C26H27F2N5O4S |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 1-carbamoyl-3-[(3,4-difluoro-5-methylphenyl)methyl]-3-[(4-methoxyanilino)methyl]-1-[(6-oxo-3,7-dihydro-2H-thieno[2,3-b]pyridin-5-yl)methyl]urea |
| SMILES | COc1ccc(NCN(Cc2cc(C)c(F)c(F)c2)C(=O)N(Cc2cc3c([nH]c2=O)SCC3)C(N)=O)cc1 |
| InChI | InChI=1S/C26H27F2N5O4S/c1-15-9-16(10-21(27)22(15)28)12-32(14-30-19-3-5-20(37-2)6-4-19)26(36)33(25(29)35)13-18-11-17-7-8-38-24(17)31-23(18)34/h3-6,9-11,30H,7-8,12-14H2,1-2H3,(H2,29,35)(H,31,34) |
| InChIKey | UOAQJECJIKENKX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|