C26H25F3NO2+ — CID 175623137
2-[[(Z)-4-methoxypent-3-en-2-yl]oxymethyl]-5-(trifluoromethyl)-18-azoniapentacyclo[14.2.1.03,8.09,18.012,17]nonadeca-3(8),4,6,9(18),10,12(17),13,15-octaene (PubChem CID 175623137) has the molecular formula C26H25F3NO2+ and a molecular weight of 440.49 g/mol. Its IUPAC name is 2-[[(Z)-4-methoxypent-3-en-2-yl]oxymethyl]-5-(trifluoromethyl)-18-azoniapentacyclo[14.2.1.03,8.09,18.012,17]nonadeca-3(8),4,6,9(18),10,12(17),13,15-octaene.
| Compound Name | 2-[[(Z)-4-methoxypent-3-en-2-yl]oxymethyl]-5-(trifluoromethyl)-18-azoniapentacyclo[14.2.1.03,8.09,18.012,17]nonadeca-3(8),4,6,9(18),10,12(17),13,15-octaene |
|---|---|
| PubChem CID | 175623137 |
| Molecular Formula | C26H25F3NO2+ |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2-[[(Z)-4-methoxypent-3-en-2-yl]oxymethyl]-5-(trifluoromethyl)-18-azoniapentacyclo[14.2.1.03,8.09,18.012,17]nonadeca-3(8),4,6,9(18),10,12(17),13,15-octaene |
| SMILES | CO/C(C)=C\C(C)OCC1c2cc(C(F)(F)F)ccc2-c2ccc3cccc4c3[n+]2C1C4 |
| InChI | InChI=1S/C26H25F3NO2/c1-15(31-3)11-16(2)32-14-22-21-13-19(26(27,28)29)8-9-20(21)23-10-7-17-5-4-6-18-12-24(22)30(23)25(17)18/h4-11,13,16,22,24H,12,14H2,1-3H3/q+1/b15-11- |
| InChIKey | QIWBKEGGKVIHLW-PTNGSMBKSA-N |
| XLogP | 5.96 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|