About 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one
2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one (PubChem CID 175623877) has the molecular formula C9H8ClN3O
and a molecular weight of 209.64 g/mol. Its IUPAC name is 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one.
Molecular Properties
| Compound Name | 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one |
| PubChem CID | 175623877 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one |
| SMILES | Cc1nc(Cl)nc2c1C1(CC1)C(=O)N2 |
| InChI | InChI=1S/C9H8ClN3O/c1-4-5-6(13-8(10)11-4)12-7(14)9(5)2-3-9/h2-3H2,1H3,(H,11,12,13,14) |
| InChIKey | KEHMGCLXNWSNIJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one?
The IUPAC name of 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one (CID 175623877) is 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one.
What is the SMILES notation for 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one?
The canonical SMILES for 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one is Cc1nc(Cl)nc2c1C1(CC1)C(=O)N2.
What is the InChIKey of 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one?
The InChIKey is KEHMGCLXNWSNIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN3O/c1-4-5-6(13-8(10)11-4)12-7(14)9(5)2-3-9/h2-3H2,1H3,(H,11,12,13,14).
What are the key properties of 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one?
2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one has a molecular weight of 209.64 g/mol, XLogP of 1.42, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methylspiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one is sourced from PubChem (CID 175623877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).