C13H12ClF3N4OP2S — CID 175623963
2-[N-[bis(phosphanyl)methyl]-C-methylcarbonimidoyl]-N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide (PubChem CID 175623963) has the molecular formula C13H12ClF3N4OP2S and a molecular weight of 426.73 g/mol. Its IUPAC name is 2-[N-[bis(phosphanyl)methyl]-C-methylcarbonimidoyl]-N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[N-[bis(phosphanyl)methyl]-C-methylcarbonimidoyl]-N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 175623963 |
| Molecular Formula | C13H12ClF3N4OP2S |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | 2-[N-[bis(phosphanyl)methyl]-C-methylcarbonimidoyl]-N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide |
| SMILES | CC(=NC(P)P)c1ncc(C(=O)Nc2cc(C(F)(F)F)c(Cl)cn2)s1 |
| InChI | InChI=1S/C13H12ClF3N4OP2S/c1-5(20-12(23)24)11-19-4-8(25-11)10(22)21-9-2-6(13(15,16)17)7(14)3-18-9/h2-4,12H,23-24H2,1H3,(H,18,21,22) |
| InChIKey | HFWMURYFHPGPTD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|