C24H26F3N3O2 — CID 175624701
3-[4-[5-[[4-(trifluoromethyl)cyclohexyl]methoxy]-3-pyridinyl]morpholin-2-yl]benzonitrile (PubChem CID 175624701) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is 3-[4-[5-[[4-(trifluoromethyl)cyclohexyl]methoxy]-3-pyridinyl]morpholin-2-yl]benzonitrile.
| Compound Name | 3-[4-[5-[[4-(trifluoromethyl)cyclohexyl]methoxy]-3-pyridinyl]morpholin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 175624701 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-[4-[5-[[4-(trifluoromethyl)cyclohexyl]methoxy]-3-pyridinyl]morpholin-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(C2CN(c3cncc(OCC4CCC(C(F)(F)F)CC4)c3)CCO2)c1 |
| InChI | InChI=1S/C24H26F3N3O2/c25-24(26,27)20-6-4-17(5-7-20)16-32-22-11-21(13-29-14-22)30-8-9-31-23(15-30)19-3-1-2-18(10-19)12-28/h1-3,10-11,13-14,17,20,23H,4-9,15-16H2 |
| InChIKey | AZCJWOBWOHQMLM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 58.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |