C31H35F6N3O8S — CID 175624711
tert-butyl 5-hydroxy-4-[[2-[4-methoxycarbonyl-3-(trifluoromethylsulfonyloxy)phenyl]-4-(3,3,3-trifluoropropyl)piperazin-1-yl]methyl]-7-methylindole-1-carboxylate (PubChem CID 175624711) has the molecular formula C31H35F6N3O8S and a molecular weight of 723.69 g/mol. Its IUPAC name is tert-butyl 5-hydroxy-4-[[2-[4-methoxycarbonyl-3-(trifluoromethylsulfonyloxy)phenyl]-4-(3,3,3-trifluoropropyl)piperazin-1-yl]methyl]-7-methylindole-1-carboxylate.
| Compound Name | tert-butyl 5-hydroxy-4-[[2-[4-methoxycarbonyl-3-(trifluoromethylsulfonyloxy)phenyl]-4-(3,3,3-trifluoropropyl)piperazin-1-yl]methyl]-7-methylindole-1-carboxylate |
|---|---|
| PubChem CID | 175624711 |
| Molecular Formula | C31H35F6N3O8S |
| Molecular Weight | 723.69 g/mol |
| Exact Mass | 723.20 |
| IUPAC Name | tert-butyl 5-hydroxy-4-[[2-[4-methoxycarbonyl-3-(trifluoromethylsulfonyloxy)phenyl]-4-(3,3,3-trifluoropropyl)piperazin-1-yl]methyl]-7-methylindole-1-carboxylate |
| SMILES | COC(=O)c1ccc(C2CN(CCC(F)(F)F)CCN2Cc2c(O)cc(C)c3c2ccn3C(=O)OC(C)(C)C)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C31H35F6N3O8S/c1-18-14-24(41)22(20-8-10-40(26(18)20)28(43)47-29(2,3)4)16-39-13-12-38(11-9-30(32,33)34)17-23(39)19-6-7-21(27(42)46-5)25(15-19)48-49(44,45)31(35,36)37/h6-8,10,14-15,23,41H,9,11-13,16-17H2,1-5H3 |
| InChIKey | BGSXWVZOSYJJRX-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|