About 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine
3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine (PubChem CID 175624755) has the molecular formula C10H15FN2
and a molecular weight of 182.24 g/mol. Its IUPAC name is 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine |
| PubChem CID | 175624755 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine |
| SMILES | Cc1nc(N)c(F)c(C(C)C)c1C |
| InChI | InChI=1S/C10H15FN2/c1-5(2)8-6(3)7(4)13-10(12)9(8)11/h5H,1-4H3,(H2,12,13) |
| InChIKey | PLJXHYFWZHOOCL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine?
The IUPAC name of 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine (CID 175624755) is 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine.
What is the SMILES notation for 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine?
The canonical SMILES for 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine is Cc1nc(N)c(F)c(C(C)C)c1C.
What is the InChIKey of 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine?
The InChIKey is PLJXHYFWZHOOCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2/c1-5(2)8-6(3)7(4)13-10(12)9(8)11/h5H,1-4H3,(H2,12,13).
What are the key properties of 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine?
3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine has a molecular weight of 182.24 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5,6-dimethyl-4-propan-2-ylpyridin-2-amine is sourced from PubChem (CID 175624755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).