About CID 175625775
CID 175625775 (PubChem CID 175625775) has the molecular formula C24H27B4I2N5O11S2
and a molecular weight of 922.69 g/mol.
Molecular Properties
| Compound Name | CID 175625775 |
| PubChem CID | 175625775 |
| Molecular Formula | C24H27B4I2N5O11S2 |
| Molecular Weight | 922.69 g/mol |
| Exact Mass | 922.96 |
| IUPAC Name | — |
| SMILES | [B]/B=S(\I)OC(=O)N(C)CC(=O)Nc1cc(COC(=O)n2cncn2)ccc1O[C@@H]1OC(C(=O)B(I)B=S=O)[C@@H](C)[C@H](C)C1OC(C)=O |
| InChI | InChI=1S/C24H27B4I2N5O11S2/c1-12-13(2)20(43-14(3)36)22(45-19(12)21(38)28(29)27-47-41)44-17-6-5-15(9-42-24(40)35-11-31-10-32-35)7-16(17)33-18(37)8-34(4)23(39)46-48(30)26-25/h5-7,10-13,19-20,22H,8-9H2,1-4H3,(H,33,37)/t12-,13-,19?,20?,22+,48?/m0/s1 |
| InChIKey | DTTJSZGEFMTULS-ZTFVJWIPSA-N |
| XLogP | 1.88 |
| TPSA | 194.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 922.69 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 175625775 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175625775?
The IUPAC name of CID 175625775 (CID 175625775) is not available.
What is the SMILES notation for CID 175625775?
The canonical SMILES for CID 175625775 is [B]/B=S(\I)OC(=O)N(C)CC(=O)Nc1cc(COC(=O)n2cncn2)ccc1O[C@@H]1OC(C(=O)B(I)B=S=O)[C@@H](C)[C@H](C)C1OC(C)=O.
What is the InChIKey of CID 175625775?
The InChIKey is DTTJSZGEFMTULS-ZTFVJWIPSA-N. The full InChI is InChI=1S/C24H27B4I2N5O11S2/c1-12-13(2)20(43-14(3)36)22(45-19(12)21(38)28(29)27-47-41)44-17-6-5-15(9-42-24(40)35-11-31-10-32-35)7-16(17)33-18(37)8-34(4)23(39)46-48(30)26-25/h5-7,10-13,19-20,22H,8-9H2,1-4H3,(H,33,37)/t12-,13-,19?,20?,22+,48?/m0/s1.
What are the key properties of CID 175625775?
CID 175625775 has a molecular weight of 922.69 g/mol, XLogP of 1.88, 12 rotatable bonds, 1 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175625775 is sourced from PubChem (CID 175625775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).