C20H24ClFN8O — CID 175626519
(Z)-2-amino-3-[amino-[2-[(1-ethenyl-2H-pyridin-2-yl)amino]ethyl]amino]-N-[(7-chloro-8-fluoroimidazo[1,5-a]pyridin-1-yl)methyl]prop-2-enamide (PubChem CID 175626519) has the molecular formula C20H24ClFN8O and a molecular weight of 446.92 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[2-[(1-ethenyl-2H-pyridin-2-yl)amino]ethyl]amino]-N-[(7-chloro-8-fluoroimidazo[1,5-a]pyridin-1-yl)methyl]prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[2-[(1-ethenyl-2H-pyridin-2-yl)amino]ethyl]amino]-N-[(7-chloro-8-fluoroimidazo[1,5-a]pyridin-1-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 175626519 |
| Molecular Formula | C20H24ClFN8O |
| Molecular Weight | 446.92 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (Z)-2-amino-3-[amino-[2-[(1-ethenyl-2H-pyridin-2-yl)amino]ethyl]amino]-N-[(7-chloro-8-fluoroimidazo[1,5-a]pyridin-1-yl)methyl]prop-2-enamide |
| SMILES | C=CN1C=CC=CC1NCCN(N)/C=C(\N)C(=O)NCc1ncn2ccc(Cl)c(F)c12 |
| InChI | InChI=1S/C20H24ClFN8O/c1-2-28-8-4-3-5-17(28)25-7-10-30(24)12-15(23)20(31)26-11-16-19-18(22)14(21)6-9-29(19)13-27-16/h2-6,8-9,12-13,17,25H,1,7,10-11,23-24H2,(H,26,31)/b15-12- |
| InChIKey | XGDVTGZEACZBSF-QINSGFPZSA-N |
| XLogP | 1.16 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.92 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|