C16H19F3N6O3 — CID 175626534
(2R,3R,4R,5S)-2-[[(4-methylpyrimidin-2-yl)amino]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 175626534) has the molecular formula C16H19F3N6O3 and a molecular weight of 400.36 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[[(4-methylpyrimidin-2-yl)amino]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[[(4-methylpyrimidin-2-yl)amino]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 175626534 |
| Molecular Formula | C16H19F3N6O3 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2R,3R,4R,5S)-2-[[(4-methylpyrimidin-2-yl)amino]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | Cc1ccnc(NC[C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C16H19F3N6O3/c1-8-2-3-21-15(23-8)22-4-10-14(27)13(26)9(7-28-10)24-12-6-20-5-11(25-12)16(17,18)19/h2-3,5-6,9-10,13-14,26-27H,4,7H2,1H3,(H,24,25)(H,21,22,23)/t9-,10+,13+,14-/m0/s1 |
| InChIKey | HBNVTIZFXJYTTF-PJQZNRQZSA-N |
| XLogP | 0.61 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |