About N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide
N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide (PubChem CID 175626699) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide |
| PubChem CID | 175626699 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide |
| SMILES | C=C/C=C(CCC)/N=C/N(C)/C=C\CC |
| InChI | InChI=1S/C13H22N2/c1-5-8-11-15(4)12-14-13(9-6-2)10-7-3/h6,8-9,11-12H,2,5,7,10H2,1,3-4H3/b11-8-,13-9+,14-12+ |
| InChIKey | VRNFYBTXNNNADL-NNRLMOERSA-N |
| XLogP | 3.74 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide?
The IUPAC name of N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide (CID 175626699) is N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide.
What is the SMILES notation for N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide?
The canonical SMILES for N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide is C=C/C=C(CCC)/N=C/N(C)/C=C\CC.
What is the InChIKey of N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide?
The InChIKey is VRNFYBTXNNNADL-NNRLMOERSA-N. The full InChI is InChI=1S/C13H22N2/c1-5-8-11-15(4)12-14-13(9-6-2)10-7-3/h6,8-9,11-12H,2,5,7,10H2,1,3-4H3/b11-8-,13-9+,14-12+.
What are the key properties of N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide?
N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide has a molecular weight of 206.33 g/mol, XLogP of 3.74, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-but-1-enyl]-N'-[(3E)-hepta-1,3-dien-4-yl]-N-methylmethanimidamide is sourced from PubChem (CID 175626699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).