C33H25NO7 — CID 175626943
6,7-dimethyl-9-[2-(9-methyldibenzofuran-2-yl)phenyl]carbazole-1,2,3,4,5,8-hexol (PubChem CID 175626943) has the molecular formula C33H25NO7 and a molecular weight of 547.56 g/mol. Its IUPAC name is 6,7-dimethyl-9-[2-(9-methyldibenzofuran-2-yl)phenyl]carbazole-1,2,3,4,5,8-hexol.
| Compound Name | 6,7-dimethyl-9-[2-(9-methyldibenzofuran-2-yl)phenyl]carbazole-1,2,3,4,5,8-hexol |
|---|---|
| PubChem CID | 175626943 |
| Molecular Formula | C33H25NO7 |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 6,7-dimethyl-9-[2-(9-methyldibenzofuran-2-yl)phenyl]carbazole-1,2,3,4,5,8-hexol |
| SMILES | Cc1c(C)c(O)c2c(c1O)c1c(O)c(O)c(O)c(O)c1n2-c1ccccc1-c1ccc2oc3cccc(C)c3c2c1 |
| InChI | InChI=1S/C33H25NO7/c1-14-7-6-10-22-23(14)19-13-17(11-12-21(19)41-22)18-8-4-5-9-20(18)34-26-24(28(35)15(2)16(3)29(26)36)25-27(34)31(38)33(40)32(39)30(25)37/h4-13,35-40H,1-3H3 |
| InChIKey | QURXTCUTCAFDNG-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 139.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|