C17H20ClFN7O2PS — CID 175627090
7-chloro-8-fluoro-5-[2-[[(1R)-1-[3-(methylphosphanylamino)pyrazin-2-yl]ethyl]amino]ethoxy]-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 175627090) has the molecular formula C17H20ClFN7O2PS and a molecular weight of 471.89 g/mol. Its IUPAC name is 7-chloro-8-fluoro-5-[2-[[(1R)-1-[3-(methylphosphanylamino)pyrazin-2-yl]ethyl]amino]ethoxy]-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 7-chloro-8-fluoro-5-[2-[[(1R)-1-[3-(methylphosphanylamino)pyrazin-2-yl]ethyl]amino]ethoxy]-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 175627090 |
| Molecular Formula | C17H20ClFN7O2PS |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 7-chloro-8-fluoro-5-[2-[[(1R)-1-[3-(methylphosphanylamino)pyrazin-2-yl]ethyl]amino]ethoxy]-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | CPNc1nccnc1[C@@H](C)NCCOc1nc(Cl)c(F)c2nc(SC)[nH]c(=O)c12 |
| InChI | InChI=1S/C17H20ClFN7O2PS/c1-8(11-14(26-29-2)22-5-4-21-11)20-6-7-28-16-9-12(10(19)13(18)24-16)23-17(30-3)25-15(9)27/h4-5,8,20,29H,6-7H2,1-3H3,(H,22,26)(H,23,25,27)/t8-/m1/s1 |
| InChIKey | RXMNVQISIGLEFI-MRVPVSSYSA-N |
| XLogP | 2.99 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|