About ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate
ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate (PubChem CID 175627655) has the molecular formula C23H35N3O4
and a molecular weight of 417.55 g/mol. Its IUPAC name is ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate |
| PubChem CID | 175627655 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate |
| SMILES | CCOC(=O)NC1CC(C(=O)N2CCC3(CC2)CC(c2nc(C(C)(C)C)co2)C3)C1 |
| InChI | InChI=1S/C23H35N3O4/c1-5-29-21(28)24-17-10-15(11-17)20(27)26-8-6-23(7-9-26)12-16(13-23)19-25-18(14-30-19)22(2,3)4/h14-17H,5-13H2,1-4H3,(H,24,28) |
| InChIKey | AVEQVNUSLQVJOP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate?
The IUPAC name of ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate (CID 175627655) is ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate.
What is the SMILES notation for ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate?
The canonical SMILES for ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate is CCOC(=O)NC1CC(C(=O)N2CCC3(CC2)CC(c2nc(C(C)(C)C)co2)C3)C1.
What is the InChIKey of ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate?
The InChIKey is AVEQVNUSLQVJOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H35N3O4/c1-5-29-21(28)24-17-10-15(11-17)20(27)26-8-6-23(7-9-26)12-16(13-23)19-25-18(14-30-19)22(2,3)4/h14-17H,5-13H2,1-4H3,(H,24,28).
What are the key properties of ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate?
ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate has a molecular weight of 417.55 g/mol, XLogP of 3.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[3-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate is sourced from PubChem (CID 175627655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).