C18H20N6 — CID 175627777
5-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,3-b]pyrazin-3-amine (PubChem CID 175627777) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is 5-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,3-b]pyrazin-3-amine.
| Compound Name | 5-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,3-b]pyrazin-3-amine |
|---|---|
| PubChem CID | 175627777 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 5-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,3-b]pyrazin-3-amine |
| SMILES | C=C/C(=C\C=C/C)Cn1ccc2ncc(Nc3cc(C)[nH]n3)nc21 |
| InChI | InChI=1S/C18H20N6/c1-4-6-7-14(5-2)12-24-9-8-15-18(24)21-17(11-19-15)20-16-10-13(3)22-23-16/h4-11H,2,12H2,1,3H3,(H2,20,21,22,23)/b6-4-,14-7+ |
| InChIKey | LXTOWFFZZDXKNT-HERXPTLBSA-N |
| XLogP | 3.89 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|