About 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole
2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole (PubChem CID 175628097) has the molecular formula C17H33N
and a molecular weight of 251.46 g/mol. Its IUPAC name is 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole |
| PubChem CID | 175628097 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole |
| SMILES | CCCCCCC(C)(CCCCC)C1CC=CN1 |
| InChI | InChI=1S/C17H33N/c1-4-6-8-10-14-17(3,13-9-7-5-2)16-12-11-15-18-16/h11,15-16,18H,4-10,12-14H2,1-3H3 |
| InChIKey | AMMRPLMVKXQCDM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole?
The IUPAC name of 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole (CID 175628097) is 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole.
What is the SMILES notation for 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole?
The canonical SMILES for 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole is CCCCCCC(C)(CCCCC)C1CC=CN1.
What is the InChIKey of 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole?
The InChIKey is AMMRPLMVKXQCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N/c1-4-6-8-10-14-17(3,13-9-7-5-2)16-12-11-15-18-16/h11,15-16,18H,4-10,12-14H2,1-3H3.
What are the key properties of 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole?
2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole has a molecular weight of 251.46 g/mol, XLogP of 5.42, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyldodecan-6-yl)-2,3-dihydro-1H-pyrrole is sourced from PubChem (CID 175628097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).