C30H30N2O+2 — CID 175628539
6,6-diethyl-10'-methoxy-9'-methylspiro[benzo[a]quinolizin-5-ium-7,6'-pyrido[2,1-a]isoindol-5-ium] (PubChem CID 175628539) has the molecular formula C30H30N2O+2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 6,6-diethyl-10'-methoxy-9'-methylspiro[benzo[a]quinolizin-5-ium-7,6'-pyrido[2,1-a]isoindol-5-ium].
| Compound Name | 6,6-diethyl-10'-methoxy-9'-methylspiro[benzo[a]quinolizin-5-ium-7,6'-pyrido[2,1-a]isoindol-5-ium] |
|---|---|
| PubChem CID | 175628539 |
| Molecular Formula | C30H30N2O+2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 6,6-diethyl-10'-methoxy-9'-methylspiro[benzo[a]quinolizin-5-ium-7,6'-pyrido[2,1-a]isoindol-5-ium] |
| SMILES | CCC1(CC)[n+]2ccccc2-c2ccccc2C12c1ccc(C)c(OC)c1-c1cccc[n+]12 |
| InChI | InChI=1S/C30H30N2O/c1-5-29(6-2)30(23-14-8-7-13-22(23)25-15-9-11-19-31(25)29)24-18-17-21(3)28(33-4)27(24)26-16-10-12-20-32(26)30/h7-20H,5-6H2,1-4H3/q+2 |
| InChIKey | OHDPYYLJBQSBEX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|