C27H32ClF2N7O4 — CID 175629514
tert-butyl N-[3-[(1R)-1-[[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-oxo-6H-pyrido[4,3-d]pyrimidin-4-yl]amino]ethyl]-2-pyridinyl]carbamate (PubChem CID 175629514) has the molecular formula C27H32ClF2N7O4 and a molecular weight of 592.05 g/mol. Its IUPAC name is tert-butyl N-[3-[(1R)-1-[[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-oxo-6H-pyrido[4,3-d]pyrimidin-4-yl]amino]ethyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[3-[(1R)-1-[[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-oxo-6H-pyrido[4,3-d]pyrimidin-4-yl]amino]ethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 175629514 |
| Molecular Formula | C27H32ClF2N7O4 |
| Molecular Weight | 592.05 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | tert-butyl N-[3-[(1R)-1-[[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-oxo-6H-pyrido[4,3-d]pyrimidin-4-yl]amino]ethyl]-2-pyridinyl]carbamate |
| SMILES | C[C@@H](Nc1nc(OC[C@@]23CCCN2C[C@H](F)C3)nc2c(F)c(Cl)[nH]c(=O)c12)c1cccnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H32ClF2N7O4/c1-14(16-7-5-9-31-21(16)36-25(39)41-26(2,3)4)32-22-17-19(18(30)20(28)34-23(17)38)33-24(35-22)40-13-27-8-6-10-37(27)12-15(29)11-27/h5,7,9,14-15H,6,8,10-13H2,1-4H3,(H,34,38)(H,31,36,39)(H,32,33,35)/t14-,15-,27+/m1/s1 |
| InChIKey | ZPLGQZVHKGFGML-RHFKOARHSA-N |
| XLogP | 4.98 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.05 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|