C32H5F3N10 — CID 175629677
2,6-bis(2-cyano-6-fluoro-3-pyridinyl)-3,5-bis(dicyanomethylidene)-8-fluoro-s-indacene-1,7-dicarbonitrile (PubChem CID 175629677) has the molecular formula C32H5F3N10 and a molecular weight of 586.46 g/mol. Its IUPAC name is 2,6-bis(2-cyano-6-fluoro-3-pyridinyl)-3,5-bis(dicyanomethylidene)-8-fluoro-s-indacene-1,7-dicarbonitrile.
| Compound Name | 2,6-bis(2-cyano-6-fluoro-3-pyridinyl)-3,5-bis(dicyanomethylidene)-8-fluoro-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 175629677 |
| Molecular Formula | C32H5F3N10 |
| Molecular Weight | 586.46 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | 2,6-bis(2-cyano-6-fluoro-3-pyridinyl)-3,5-bis(dicyanomethylidene)-8-fluoro-s-indacene-1,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2ccc(F)nc2C#N)=C(C#N)c2c1cc1c(c2F)C(C#N)=C(c2ccc(F)nc2C#N)C1=C(C#N)C#N |
| InChI | InChI=1S/C32H5F3N10/c33-24-3-1-16(22(12-42)44-24)28-20(10-40)30-18(26(28)14(6-36)7-37)5-19-27(15(8-38)9-39)29(21(11-41)31(19)32(30)35)17-2-4-25(34)45-23(17)13-43/h1-5H |
| InChIKey | USMKOOMYDYBWPS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 216.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|