C15H16F6N2O — CID 175630064
6-methyl-3-(methylamino)-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-2-one (PubChem CID 175630064) has the molecular formula C15H16F6N2O and a molecular weight of 354.29 g/mol. Its IUPAC name is 6-methyl-3-(methylamino)-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-2-one.
| Compound Name | 6-methyl-3-(methylamino)-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 175630064 |
| Molecular Formula | C15H16F6N2O |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 6-methyl-3-(methylamino)-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-2-one |
| SMILES | CNC1CC(c2c(F)ccc(F)c2F)C(C)N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C15H16F6N2O/c1-7-8(12-9(16)3-4-10(17)13(12)18)5-11(22-2)14(24)23(7)6-15(19,20)21/h3-4,7-8,11,22H,5-6H2,1-2H3 |
| InChIKey | INRPDRJIHKYKGH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|