About (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine
(3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine (PubChem CID 175630118) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine |
| PubChem CID | 175630118 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine |
| SMILES | [H]/N=C/C(=C/C=N/C)C(=C)NC |
| InChI | InChI=1S/C8H13N3/c1-7(11-3)8(6-9)4-5-10-2/h4-6,9,11H,1H2,2-3H3/b8-4-,9-6+,10-5+ |
| InChIKey | MNMNQHZXKJWIME-OEYBFCHASA-N |
| XLogP | 1.00 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine?
The IUPAC name of (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine (CID 175630118) is (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine.
What is the SMILES notation for (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine?
The canonical SMILES for (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine is [H]/N=C/C(=C/C=N/C)C(=C)NC.
What is the InChIKey of (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine?
The InChIKey is MNMNQHZXKJWIME-OEYBFCHASA-N. The full InChI is InChI=1S/C8H13N3/c1-7(11-3)8(6-9)4-5-10-2/h4-6,9,11H,1H2,2-3H3/b8-4-,9-6+,10-5+.
What are the key properties of (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine?
(3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine has a molecular weight of 151.21 g/mol, XLogP of 1.00, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-methanimidoyl-N-methyl-5-methyliminopenta-1,3-dien-2-amine is sourced from PubChem (CID 175630118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).