C25H23ClN4OS — CID 175630397
2-[2-(4-chlorophenyl)ethylamino]-2-phenyl-N-[4-(5-sulfanyl-1H-imidazol-2-yl)phenyl]acetamide (PubChem CID 175630397) has the molecular formula C25H23ClN4OS and a molecular weight of 463.01 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)ethylamino]-2-phenyl-N-[4-(5-sulfanyl-1H-imidazol-2-yl)phenyl]acetamide.
| Compound Name | 2-[2-(4-chlorophenyl)ethylamino]-2-phenyl-N-[4-(5-sulfanyl-1H-imidazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 175630397 |
| Molecular Formula | C25H23ClN4OS |
| Molecular Weight | 463.01 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 2-[2-(4-chlorophenyl)ethylamino]-2-phenyl-N-[4-(5-sulfanyl-1H-imidazol-2-yl)phenyl]acetamide |
| SMILES | O=C(Nc1ccc(-c2ncc(S)[nH]2)cc1)C(NCCc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H23ClN4OS/c26-20-10-6-17(7-11-20)14-15-27-23(18-4-2-1-3-5-18)25(31)29-21-12-8-19(9-13-21)24-28-16-22(32)30-24/h1-13,16,23,27,32H,14-15H2,(H,28,30)(H,29,31) |
| InChIKey | RBYFSLRLPRCWPP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.01 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|