C17H18ClFN7O3PS — CID 175630459
5-[(1R)-1-(7-chloro-6-fluoro-3-methylsulfonyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl)ethyl]-N-methylphosphanylpyrimidin-4-amine (PubChem CID 175630459) has the molecular formula C17H18ClFN7O3PS and a molecular weight of 485.87 g/mol. Its IUPAC name is 5-[(1R)-1-(7-chloro-6-fluoro-3-methylsulfonyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl)ethyl]-N-methylphosphanylpyrimidin-4-amine.
| Compound Name | 5-[(1R)-1-(7-chloro-6-fluoro-3-methylsulfonyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl)ethyl]-N-methylphosphanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 175630459 |
| Molecular Formula | C17H18ClFN7O3PS |
| Molecular Weight | 485.87 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 5-[(1R)-1-(7-chloro-6-fluoro-3-methylsulfonyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl)ethyl]-N-methylphosphanylpyrimidin-4-amine |
| SMILES | CPNc1ncncc1[C@@H](C)N1CCOc2nc(Cl)c(F)c3nc(S(C)(=O)=O)nc1c23 |
| InChI | InChI=1S/C17H18ClFN7O3PS/c1-8(9-6-20-7-21-14(9)25-30-2)26-4-5-29-16-10-12(11(19)13(18)23-16)22-17(24-15(10)26)31(3,27)28/h6-8,30H,4-5H2,1-3H3,(H,20,21,25)/t8-/m1/s1 |
| InChIKey | QYRKEHNHXKHMIG-MRVPVSSYSA-N |
| XLogP | 2.61 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.87 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|