C14H30N2O — CID 175630515
N-tert-butyl-N'-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylpropanimidamide (PubChem CID 175630515) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is N-tert-butyl-N'-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylpropanimidamide.
| Compound Name | N-tert-butyl-N'-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 175630515 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | N-tert-butyl-N'-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylpropanimidamide |
| SMILES | CC(C)(C)NC(=NC(O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H30N2O/c1-12(2,3)10(16-14(7,8)9)15-11(17)13(4,5)6/h11,17H,1-9H3,(H,15,16) |
| InChIKey | BZDKHVOVYQAFBH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|