C19H37NO — CID 175631076
4-(tert-butylamino)-2,2,9,9-tetramethyl-8-methylidenedecan-3-one (PubChem CID 175631076) has the molecular formula C19H37NO and a molecular weight of 295.51 g/mol. Its IUPAC name is 4-(tert-butylamino)-2,2,9,9-tetramethyl-8-methylidenedecan-3-one.
| Compound Name | 4-(tert-butylamino)-2,2,9,9-tetramethyl-8-methylidenedecan-3-one |
|---|---|
| PubChem CID | 175631076 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | 4-(tert-butylamino)-2,2,9,9-tetramethyl-8-methylidenedecan-3-one |
| SMILES | C=C(CCCC(NC(C)(C)C)C(=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H37NO/c1-14(17(2,3)4)12-11-13-15(20-19(8,9)10)16(21)18(5,6)7/h15,20H,1,11-13H2,2-10H3 |
| InChIKey | VOIRZDWUJDJBHV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|