About methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate
methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate (PubChem CID 175631123) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate.
Molecular Properties
| Compound Name | methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate |
| PubChem CID | 175631123 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate |
| SMILES | C=C(C)/C=C(C)\N=C(/C)SC |
| InChI | InChI=1S/C9H15NS/c1-7(2)6-8(3)10-9(4)11-5/h6H,1H2,2-5H3/b8-6-,10-9+ |
| InChIKey | BUOCKNMEPYGDJG-JWJWWGMXSA-N |
| XLogP | 3.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate?
The IUPAC name of methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate (CID 175631123) is methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate.
What is the SMILES notation for methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate?
The canonical SMILES for methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate is C=C(C)/C=C(C)\N=C(/C)SC.
What is the InChIKey of methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate?
The InChIKey is BUOCKNMEPYGDJG-JWJWWGMXSA-N. The full InChI is InChI=1S/C9H15NS/c1-7(2)6-8(3)10-9(4)11-5/h6H,1H2,2-5H3/b8-6-,10-9+.
What are the key properties of methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate?
methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate has a molecular weight of 169.29 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidothioate is sourced from PubChem (CID 175631123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).