C43H27N5O2S — CID 175631840
4-[4-(14,22-diphenyl-1,8,14,22-tetrazahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaen-8-yl)phenyl]sulfonylbenzonitrile (PubChem CID 175631840) has the molecular formula C43H27N5O2S and a molecular weight of 677.79 g/mol. Its IUPAC name is 4-[4-(14,22-diphenyl-1,8,14,22-tetrazahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaen-8-yl)phenyl]sulfonylbenzonitrile.
| Compound Name | 4-[4-(14,22-diphenyl-1,8,14,22-tetrazahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaen-8-yl)phenyl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 175631840 |
| Molecular Formula | C43H27N5O2S |
| Molecular Weight | 677.79 g/mol |
| Exact Mass | 677.19 |
| IUPAC Name | 4-[4-(14,22-diphenyl-1,8,14,22-tetrazahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaen-8-yl)phenyl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)c2ccc(N3c4cccc5c4N4c6c(cccc6N(c6ccccc6)c6cccc3c64)N5c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C43H27N5O2S/c44-28-29-20-24-33(25-21-29)51(49,50)34-26-22-32(23-27-34)47-39-18-8-16-37-42(39)48-41-35(45(37)30-10-3-1-4-11-30)14-7-15-36(41)46(31-12-5-2-6-13-31)38-17-9-19-40(47)43(38)48/h1-27H |
| InChIKey | MIZMESLTIBWNSU-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 70.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.79 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |