About [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium
[(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium (PubChem CID 175632370) has the molecular formula C13H15BrFNOS
and a molecular weight of 332.24 g/mol. Its IUPAC name is [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium.
Molecular Properties
| Compound Name | [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium |
| PubChem CID | 175632370 |
| Molecular Formula | C13H15BrFNOS |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N=C1CCc2cc(Br)cc(F)c21 |
| InChI | InChI=1S/C13H15BrFNOS/c1-13(2,3)18(17)16-11-5-4-8-6-9(14)7-10(15)12(8)11/h6-7H,4-5H2,1-3H3 |
| InChIKey | VQPNNZNVCPLOCA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium?
The IUPAC name of [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium (CID 175632370) is [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium.
What is the SMILES notation for [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium?
The canonical SMILES for [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium is CC(C)(C)[S+]([O-])N=C1CCc2cc(Br)cc(F)c21.
What is the InChIKey of [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium?
The InChIKey is VQPNNZNVCPLOCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrFNOS/c1-13(2,3)18(17)16-11-5-4-8-6-9(14)7-10(15)12(8)11/h6-7H,4-5H2,1-3H3.
What are the key properties of [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium?
[(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium has a molecular weight of 332.24 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)amino]-tert-butyl-oxidosulfanium is sourced from PubChem (CID 175632370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).