C19H31N3 — CID 175632558
(7E)-3-cyclopentyl-5-ethenyl-6-ethylimino-4-methylnona-2,4,7-triene-2,8-diamine (PubChem CID 175632558) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is (7E)-3-cyclopentyl-5-ethenyl-6-ethylimino-4-methylnona-2,4,7-triene-2,8-diamine.
| Compound Name | (7E)-3-cyclopentyl-5-ethenyl-6-ethylimino-4-methylnona-2,4,7-triene-2,8-diamine |
|---|---|
| PubChem CID | 175632558 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | (7E)-3-cyclopentyl-5-ethenyl-6-ethylimino-4-methylnona-2,4,7-triene-2,8-diamine |
| SMILES | C=CC(=C(C)C(=C(C)N)C1CCCC1)C(/C=C(\C)N)=N/CC |
| InChI | InChI=1S/C19H31N3/c1-6-17(18(22-7-2)12-13(3)20)14(4)19(15(5)21)16-10-8-9-11-16/h6,12,16H,1,7-11,20-21H2,2-5H3/b13-12+,17-14?,19-15?,22-18+ |
| InChIKey | UCFOYXOOSQPFSC-ASMJAQARSA-N |
| XLogP | 4.24 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|