About 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile
2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile (PubChem CID 175632778) has the molecular formula C15H6BrN3O2S
and a molecular weight of 372.20 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile |
| PubChem CID | 175632778 |
| Molecular Formula | C15H6BrN3O2S |
| Molecular Weight | 372.20 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1cc(C#N)c(S(=O)(=O)c2ccc(Br)cc2)c(C#N)c1 |
| InChI | InChI=1S/C15H6BrN3O2S/c16-13-1-3-14(4-2-13)22(20,21)15-11(8-18)5-10(7-17)6-12(15)9-19/h1-6H |
| InChIKey | VWKBUIUPDVXLAI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 105.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile?
The IUPAC name of 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile (CID 175632778) is 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile.
What is the SMILES notation for 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile?
The canonical SMILES for 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile is N#Cc1cc(C#N)c(S(=O)(=O)c2ccc(Br)cc2)c(C#N)c1.
What is the InChIKey of 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile?
The InChIKey is VWKBUIUPDVXLAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H6BrN3O2S/c16-13-1-3-14(4-2-13)22(20,21)15-11(8-18)5-10(7-17)6-12(15)9-19/h1-6H.
What are the key properties of 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile?
2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile has a molecular weight of 372.20 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)sulfonylbenzene-1,3,5-tricarbonitrile is sourced from PubChem (CID 175632778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).