C25H47N5O3 — CID 175632864
2-[[(2E,4E)-2-[4-(dimethylamino)butyl]-5-[(2-formamidoacetyl)amino]hexa-2,4-dienyl]-methylamino]-3-methyl-N-(2-methylpropyl)butanamide (PubChem CID 175632864) has the molecular formula C25H47N5O3 and a molecular weight of 465.68 g/mol. Its IUPAC name is 2-[[(2E,4E)-2-[4-(dimethylamino)butyl]-5-[(2-formamidoacetyl)amino]hexa-2,4-dienyl]-methylamino]-3-methyl-N-(2-methylpropyl)butanamide.
| Compound Name | 2-[[(2E,4E)-2-[4-(dimethylamino)butyl]-5-[(2-formamidoacetyl)amino]hexa-2,4-dienyl]-methylamino]-3-methyl-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 175632864 |
| Molecular Formula | C25H47N5O3 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.37 |
| IUPAC Name | 2-[[(2E,4E)-2-[4-(dimethylamino)butyl]-5-[(2-formamidoacetyl)amino]hexa-2,4-dienyl]-methylamino]-3-methyl-N-(2-methylpropyl)butanamide |
| SMILES | C/C(=C\C=C(/CCCCN(C)C)CN(C)C(C(=O)NCC(C)C)C(C)C)NC(=O)CNC=O |
| InChI | InChI=1S/C25H47N5O3/c1-19(2)15-27-25(33)24(20(3)4)30(8)17-22(11-9-10-14-29(6)7)13-12-21(5)28-23(32)16-26-18-31/h12-13,18-20,24H,9-11,14-17H2,1-8H3,(H,26,31)(H,27,33)(H,28,32)/b21-12+,22-13+ |
| InChIKey | DLPWDZBUIDVROK-ADYPVIEZSA-N |
| XLogP | 2.14 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|