C13H21N — CID 175632901
(3aR)-2,2,3a,6-tetramethyl-3,4,7,8-tetrahydrocyclohepta[b]pyrrole (PubChem CID 175632901) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (3aR)-2,2,3a,6-tetramethyl-3,4,7,8-tetrahydrocyclohepta[b]pyrrole.
| Compound Name | (3aR)-2,2,3a,6-tetramethyl-3,4,7,8-tetrahydrocyclohepta[b]pyrrole |
|---|---|
| PubChem CID | 175632901 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (3aR)-2,2,3a,6-tetramethyl-3,4,7,8-tetrahydrocyclohepta[b]pyrrole |
| SMILES | CC1=CC[C@]2(C)CC(C)(C)N=C2CC1 |
| InChI | InChI=1S/C13H21N/c1-10-5-6-11-13(4,8-7-10)9-12(2,3)14-11/h7H,5-6,8-9H2,1-4H3/t13-/m1/s1 |
| InChIKey | CWOKONBXFKWIBJ-CYBMUJFWSA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|