C10H9ClF3N3O3S — CID 175633075
N-[(2S)-1-[(6-chloro-5-cyano-3-pyridinyl)oxy]propan-2-yl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 175633075) has the molecular formula C10H9ClF3N3O3S and a molecular weight of 343.71 g/mol. Its IUPAC name is N-[(2S)-1-[(6-chloro-5-cyano-3-pyridinyl)oxy]propan-2-yl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(2S)-1-[(6-chloro-5-cyano-3-pyridinyl)oxy]propan-2-yl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 175633075 |
| Molecular Formula | C10H9ClF3N3O3S |
| Molecular Weight | 343.71 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | N-[(2S)-1-[(6-chloro-5-cyano-3-pyridinyl)oxy]propan-2-yl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | C[C@@H](COc1cnc(Cl)c(C#N)c1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H9ClF3N3O3S/c1-6(17-21(18,19)10(12,13)14)5-20-8-2-7(3-15)9(11)16-4-8/h2,4,6,17H,5H2,1H3/t6-/m0/s1 |
| InChIKey | MYQYIHBASDHILP-LURJTMIESA-N |
| XLogP | 1.81 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.71 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|