About N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride
N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride (PubChem CID 175633595) has the molecular formula C4H7ClN4
and a molecular weight of 146.58 g/mol. Its IUPAC name is N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride.
Molecular Properties
| Compound Name | N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride |
| PubChem CID | 175633595 |
| Molecular Formula | C4H7ClN4 |
| Molecular Weight | 146.58 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride |
| SMILES | C=NC(N)=N/C(Cl)=N/C |
| InChI | InChI=1S/C4H7ClN4/c1-7-3(5)9-4(6)8-2/h2H2,1H3,(H2,6,7,9) |
| InChIKey | NKXIZBHVEBBXIO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 63.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.58 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride?
The IUPAC name of N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride (CID 175633595) is N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride.
What is the SMILES notation for N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride?
The canonical SMILES for N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride is C=NC(N)=N/C(Cl)=N/C.
What is the InChIKey of N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride?
The InChIKey is NKXIZBHVEBBXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClN4/c1-7-3(5)9-4(6)8-2/h2H2,1H3,(H2,6,7,9).
What are the key properties of N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride?
N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride has a molecular weight of 146.58 g/mol, XLogP of 0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[amino-(methylideneamino)methylidene]-N'-methylcarbamimidoyl chloride is sourced from PubChem (CID 175633595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).