About 3-chloro-N,7-dimethylquinoxalin-2-amine
3-chloro-N,7-dimethylquinoxalin-2-amine (PubChem CID 175634550) has the molecular formula C10H10ClN3
and a molecular weight of 207.66 g/mol. Its IUPAC name is 3-chloro-N,7-dimethylquinoxalin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-N,7-dimethylquinoxalin-2-amine |
| PubChem CID | 175634550 |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 3-chloro-N,7-dimethylquinoxalin-2-amine |
| SMILES | CNc1nc2cc(C)ccc2nc1Cl |
| InChI | InChI=1S/C10H10ClN3/c1-6-3-4-7-8(5-6)14-10(12-2)9(11)13-7/h3-5H,1-2H3,(H,12,14) |
| InChIKey | FYDUHKGSSQCPPY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N,7-dimethylquinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,7-dimethylquinoxalin-2-amine?
The IUPAC name of 3-chloro-N,7-dimethylquinoxalin-2-amine (CID 175634550) is 3-chloro-N,7-dimethylquinoxalin-2-amine.
What is the SMILES notation for 3-chloro-N,7-dimethylquinoxalin-2-amine?
The canonical SMILES for 3-chloro-N,7-dimethylquinoxalin-2-amine is CNc1nc2cc(C)ccc2nc1Cl.
What is the InChIKey of 3-chloro-N,7-dimethylquinoxalin-2-amine?
The InChIKey is FYDUHKGSSQCPPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3/c1-6-3-4-7-8(5-6)14-10(12-2)9(11)13-7/h3-5H,1-2H3,(H,12,14).
What are the key properties of 3-chloro-N,7-dimethylquinoxalin-2-amine?
3-chloro-N,7-dimethylquinoxalin-2-amine has a molecular weight of 207.66 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,7-dimethylquinoxalin-2-amine is sourced from PubChem (CID 175634550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).