C29H25BNO3S — CID 175634798
CID 175634798 (PubChem CID 175634798) has the molecular formula C29H25BNO3S and a molecular weight of 478.40 g/mol.
| Compound Name | CID 175634798 |
|---|---|
| PubChem CID | 175634798 |
| Molecular Formula | C29H25BNO3S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1cccc2sc3ccc(-c4nc5ccc6ccccc6c5o4)cc3c12 |
| InChI | InChI=1S/C29H25BNO3S/c1-28(2,32)29(3,4)34-30-21-10-7-11-24-25(21)20-16-18(13-15-23(20)35-24)27-31-22-14-12-17-8-5-6-9-19(17)26(22)33-27/h5-16,32H,1-4H3 |
| InChIKey | WUIJCYYASBHDBP-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|