C22H25ClN6O2S3 — CID 175634943
[3-(2-amino-6-chloropyrimidin-4-yl)-4-[[2-[2-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]ethoxy]phenyl]methyl]pyrazol-1-yl]methanetrithiol (PubChem CID 175634943) has the molecular formula C22H25ClN6O2S3 and a molecular weight of 537.14 g/mol. Its IUPAC name is [3-(2-amino-6-chloropyrimidin-4-yl)-4-[[2-[2-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]ethoxy]phenyl]methyl]pyrazol-1-yl]methanetrithiol.
| Compound Name | [3-(2-amino-6-chloropyrimidin-4-yl)-4-[[2-[2-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]ethoxy]phenyl]methyl]pyrazol-1-yl]methanetrithiol |
|---|---|
| PubChem CID | 175634943 |
| Molecular Formula | C22H25ClN6O2S3 |
| Molecular Weight | 537.14 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | [3-(2-amino-6-chloropyrimidin-4-yl)-4-[[2-[2-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]ethoxy]phenyl]methyl]pyrazol-1-yl]methanetrithiol |
| SMILES | Nc1nc(Cl)cc(-c2nn(C(S)(S)S)cc2Cc2ccccc2OCCN2C[C@H]3C[C@@H]2CO3)n1 |
| InChI | InChI=1S/C22H25ClN6O2S3/c23-19-9-17(25-21(24)26-19)20-14(10-29(27-20)22(32,33)34)7-13-3-1-2-4-18(13)30-6-5-28-11-16-8-15(28)12-31-16/h1-4,9-10,15-16,32-34H,5-8,11-12H2,(H2,24,25,26)/t15-,16-/m1/s1 |
| InChIKey | OEZRWYHEIUBQSM-HZPDHXFCSA-N |
| XLogP | 3.38 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.14 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|