C24H27N3O3S — CID 175635308
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(2-imino-3-sulfanyliminopropanoyl)-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 175635308) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(2-imino-3-sulfanyliminopropanoyl)-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(2-imino-3-sulfanyliminopropanoyl)-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 175635308 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(2-imino-3-sulfanyliminopropanoyl)-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | [H]/N=C(\C=NS)C(=O)N1CCC2(CC1)CC(=O)C(c1c(C)cc(C#CC)cc1C)C(=O)C2 |
| InChI | InChI=1S/C24H27N3O3S/c1-4-5-17-10-15(2)21(16(3)11-17)22-19(28)12-24(13-20(22)29)6-8-27(9-7-24)23(30)18(25)14-26-31/h10-11,14,22,25,31H,6-9,12-13H2,1-3H3/b25-18+,26-14? |
| InChIKey | UVWIYNQDLZCOFB-YAZIFZCDSA-N |
| XLogP | 3.23 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|