About 1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine
1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine (PubChem CID 175635928) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine.
Analyze 1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine?
The IUPAC name of 1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine (CID 175635928) is 1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine.
What is the SMILES notation for 1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine?
The canonical SMILES for 1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine is CNC1C=CC=CC1N(C)C.
What is the InChIKey of 1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine?
The InChIKey is QZZQQSORQQWGRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-10-8-6-4-5-7-9(8)11(2)3/h4-10H,1-3H3.
What are the key properties of 1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine?
1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine has a molecular weight of 152.24 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N,2-N-trimethylcyclohexa-3,5-diene-1,2-diamine is sourced from PubChem (CID 175635928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).