About 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide
2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide (PubChem CID 175635987) has the molecular formula C14H26F2N2O2
and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide |
| PubChem CID | 175635987 |
| Molecular Formula | C14H26F2N2O2 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide |
| SMILES | COCCCC1CCN(CC(=O)NC(C)C)CC1(F)F |
| InChI | InChI=1S/C14H26F2N2O2/c1-11(2)17-13(19)9-18-7-6-12(5-4-8-20-3)14(15,16)10-18/h11-12H,4-10H2,1-3H3,(H,17,19) |
| InChIKey | FERXXVBWPFKQSR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide?
The IUPAC name of 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide (CID 175635987) is 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide?
The canonical SMILES for 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide is COCCCC1CCN(CC(=O)NC(C)C)CC1(F)F.
What is the InChIKey of 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide?
The InChIKey is FERXXVBWPFKQSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F2N2O2/c1-11(2)17-13(19)9-18-7-6-12(5-4-8-20-3)14(15,16)10-18/h11-12H,4-10H2,1-3H3,(H,17,19).
What are the key properties of 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide?
2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide has a molecular weight of 292.37 g/mol, XLogP of 1.89, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,3-difluoro-4-(3-methoxypropyl)piperidin-1-yl]-N-propan-2-ylacetamide is sourced from PubChem (CID 175635987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).