About (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole
(3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole (PubChem CID 175637052) has the molecular formula C8H10IN
and a molecular weight of 247.08 g/mol. Its IUPAC name is (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole.
Molecular Properties
| Compound Name | (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole |
| PubChem CID | 175637052 |
| Molecular Formula | C8H10IN |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole |
| SMILES | C/C(I)=C\C=C1\C=CNC1 |
| InChI | InChI=1S/C8H10IN/c1-7(9)2-3-8-4-5-10-6-8/h2-5,10H,6H2,1H3/b7-2+,8-3- |
| InChIKey | YEHJLSWVMCGBJX-QUJXVZSASA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole?
The IUPAC name of (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole (CID 175637052) is (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole.
What is the SMILES notation for (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole?
The canonical SMILES for (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole is C/C(I)=C\C=C1\C=CNC1.
What is the InChIKey of (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole?
The InChIKey is YEHJLSWVMCGBJX-QUJXVZSASA-N. The full InChI is InChI=1S/C8H10IN/c1-7(9)2-3-8-4-5-10-6-8/h2-5,10H,6H2,1H3/b7-2+,8-3-.
What are the key properties of (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole?
(3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole has a molecular weight of 247.08 g/mol, XLogP of 2.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(E)-3-iodobut-2-enylidene]-1,2-dihydropyrrole is sourced from PubChem (CID 175637052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).