C13H21NO — CID 175637265
(3E,5Z)-5-methyl-2-[(2S)-piperidin-2-yl]hepta-1,3,5-trien-4-ol (PubChem CID 175637265) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (3E,5Z)-5-methyl-2-[(2S)-piperidin-2-yl]hepta-1,3,5-trien-4-ol.
| Compound Name | (3E,5Z)-5-methyl-2-[(2S)-piperidin-2-yl]hepta-1,3,5-trien-4-ol |
|---|---|
| PubChem CID | 175637265 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (3E,5Z)-5-methyl-2-[(2S)-piperidin-2-yl]hepta-1,3,5-trien-4-ol |
| SMILES | C=C(/C=C(O)\C(C)=C/C)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C13H21NO/c1-4-10(2)13(15)9-11(3)12-7-5-6-8-14-12/h4,9,12,14-15H,3,5-8H2,1-2H3/b10-4-,13-9+/t12-/m0/s1 |
| InChIKey | ICPSBOVELAFOTL-SFHOZAJSSA-N |
| XLogP | 3.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|