C23H31N5O2 — CID 175637938
N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2S,5S)-2,5-dimethyl-2-[4-(methylamino)phenyl]piperidin-1-yl]-2-oxoacetamide (PubChem CID 175637938) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2S,5S)-2,5-dimethyl-2-[4-(methylamino)phenyl]piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2S,5S)-2,5-dimethyl-2-[4-(methylamino)phenyl]piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 175637938 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2S,5S)-2,5-dimethyl-2-[4-(methylamino)phenyl]piperidin-1-yl]-2-oxoacetamide |
| SMILES | CCc1cc(NC(=O)C(=O)N2C[C@@H](C)CC[C@@]2(C)c2ccc(NC)cc2)cnc1N |
| InChI | InChI=1S/C23H31N5O2/c1-5-16-12-19(13-26-20(16)24)27-21(29)22(30)28-14-15(2)10-11-23(28,3)17-6-8-18(25-4)9-7-17/h6-9,12-13,15,25H,5,10-11,14H2,1-4H3,(H2,24,26)(H,27,29)/t15-,23-/m0/s1 |
| InChIKey | NENXEFDXLFJSPZ-WNSKOXEYSA-N |
| XLogP | 3.38 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|