C21H25N3O4S — CID 175638883
tert-butyl 2-(6,8-dioxo-2,7-diazaspiro[4.6]undecan-2-yl)-1,3-benzothiazole-6-carboxylate (PubChem CID 175638883) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is tert-butyl 2-(6,8-dioxo-2,7-diazaspiro[4.6]undecan-2-yl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | tert-butyl 2-(6,8-dioxo-2,7-diazaspiro[4.6]undecan-2-yl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 175638883 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | tert-butyl 2-(6,8-dioxo-2,7-diazaspiro[4.6]undecan-2-yl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc2nc(N3CCC4(CCCC(=O)NC4=O)C3)sc2c1 |
| InChI | InChI=1S/C21H25N3O4S/c1-20(2,3)28-17(26)13-6-7-14-15(11-13)29-19(22-14)24-10-9-21(12-24)8-4-5-16(25)23-18(21)27/h6-7,11H,4-5,8-10,12H2,1-3H3,(H,23,25,27) |
| InChIKey | OAFUBOVYLQNAJQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|