C22H22FN3OS — CID 175639082
2-fluoro-4-[2-(4-methyl-2,3-dihydro-1,2-thiazol-5-yl)-3-(morpholin-2-ylmethyl)phenyl]benzonitrile (PubChem CID 175639082) has the molecular formula C22H22FN3OS and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-fluoro-4-[2-(4-methyl-2,3-dihydro-1,2-thiazol-5-yl)-3-(morpholin-2-ylmethyl)phenyl]benzonitrile.
| Compound Name | 2-fluoro-4-[2-(4-methyl-2,3-dihydro-1,2-thiazol-5-yl)-3-(morpholin-2-ylmethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 175639082 |
| Molecular Formula | C22H22FN3OS |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-fluoro-4-[2-(4-methyl-2,3-dihydro-1,2-thiazol-5-yl)-3-(morpholin-2-ylmethyl)phenyl]benzonitrile |
| SMILES | CC1=C(c2c(CC3CNCCO3)cccc2-c2ccc(C#N)c(F)c2)SNC1 |
| InChI | InChI=1S/C22H22FN3OS/c1-14-12-26-28-22(14)21-16(9-18-13-25-7-8-27-18)3-2-4-19(21)15-5-6-17(11-24)20(23)10-15/h2-6,10,18,25-26H,7-9,12-13H2,1H3 |
| InChIKey | GIBBIHPYXFYDCX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|