C13H12BrN3O2 — CID 175639476
5-bromo-1-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]indole-2,3-dione (PubChem CID 175639476) has the molecular formula C13H12BrN3O2 and a molecular weight of 322.16 g/mol. Its IUPAC name is 5-bromo-1-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]indole-2,3-dione.
| Compound Name | 5-bromo-1-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]indole-2,3-dione |
|---|---|
| PubChem CID | 175639476 |
| Molecular Formula | C13H12BrN3O2 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 5-bromo-1-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]indole-2,3-dione |
| SMILES | N/C=C\C=C(/N)CN1C(=O)C(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C13H12BrN3O2/c14-8-3-4-11-10(6-8)12(18)13(19)17(11)7-9(16)2-1-5-15/h1-6H,7,15-16H2/b5-1-,9-2- |
| InChIKey | XPBUTTMAAVVGIM-UOJIIDGPSA-N |
| XLogP | 1.29 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|