C12H17BrN4O2S — CID 175639566
(1R)-1-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethane-1,2-diol bromide (PubChem CID 175639566) has the molecular formula C12H17BrN4O2S and a molecular weight of 361.27 g/mol. Its IUPAC name is (1R)-1-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethane-1,2-diol bromide.
| Compound Name | (1R)-1-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethane-1,2-diol bromide |
|---|---|
| PubChem CID | 175639566 |
| Molecular Formula | C12H17BrN4O2S |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | (1R)-1-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethane-1,2-diol bromide |
| SMILES | Cc1ncc(C[n+]2csc([C@H](O)CO)c2C)c(N)n1.[Br-] |
| InChI | InChI=1S/C12H17N4O2S.BrH/c1-7-11(10(18)5-17)19-6-16(7)4-9-3-14-8(2)15-12(9)13;/h3,6,10,17-18H,4-5H2,1-2H3,(H2,13,14,15);1H/q+1;/p-1/t10-;/m1./s1 |
| InChIKey | HJSDVJAOCIKOFH-HNCPQSOCSA-M |
| XLogP | -2.90 |
| TPSA | 96.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|