C20H42NO7P — CID 175639671
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hexoxypropyl] nonanoate (PubChem CID 175639671) has the molecular formula C20H42NO7P and a molecular weight of 439.53 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hexoxypropyl] nonanoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hexoxypropyl] nonanoate |
|---|---|
| PubChem CID | 175639671 |
| Molecular Formula | C20H42NO7P |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hexoxypropyl] nonanoate |
| SMILES | CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OCCCCCC |
| InChI | InChI=1S/C20H42NO7P/c1-3-5-7-9-10-11-13-20(22)26-17-19(25-15-12-8-6-4-2)18-28-29(23,24)27-16-14-21/h19H,3-18,21H2,1-2H3,(H,23,24)/t19-/m1/s1 |
| InChIKey | WXUAQQOLBSZKRN-LJQANCHMSA-N |
| XLogP | 4.34 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|