About (3,5-ditert-butylphenyl) N-methylcarbamate
(3,5-ditert-butylphenyl) N-methylcarbamate (PubChem CID 17564) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl) N-methylcarbamate.
Molecular Properties
| Compound Name | (3,5-ditert-butylphenyl) N-methylcarbamate |
| PubChem CID | 17564 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (3,5-ditert-butylphenyl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H25NO2/c1-15(2,3)11-8-12(16(4,5)6)10-13(9-11)19-14(18)17-7/h8-10H,1-7H3,(H,17,18) |
| InChIKey | SLZWBCGZQRRUNG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3,5-ditert-butylphenyl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-ditert-butylphenyl) N-methylcarbamate?
The IUPAC name of (3,5-ditert-butylphenyl) N-methylcarbamate (CID 17564) is (3,5-ditert-butylphenyl) N-methylcarbamate.
What is the SMILES notation for (3,5-ditert-butylphenyl) N-methylcarbamate?
The canonical SMILES for (3,5-ditert-butylphenyl) N-methylcarbamate is CNC(=O)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1.
What is the InChIKey of (3,5-ditert-butylphenyl) N-methylcarbamate?
The InChIKey is SLZWBCGZQRRUNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-15(2,3)11-8-12(16(4,5)6)10-13(9-11)19-14(18)17-7/h8-10H,1-7H3,(H,17,18).
What are the key properties of (3,5-ditert-butylphenyl) N-methylcarbamate?
(3,5-ditert-butylphenyl) N-methylcarbamate has a molecular weight of 263.38 g/mol, XLogP of 4.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-ditert-butylphenyl) N-methylcarbamate is sourced from PubChem (CID 17564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).