C47H60NO2P — CID 175640382
1,10-bis(3,5-ditert-butylphenyl)-N,N-dimethyl-4,5,6,7-tetrahydroiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocin-12-amine (PubChem CID 175640382) has the molecular formula C47H60NO2P and a molecular weight of 701.98 g/mol. Its IUPAC name is 1,10-bis(3,5-ditert-butylphenyl)-N,N-dimethyl-4,5,6,7-tetrahydroiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocin-12-amine.
| Compound Name | 1,10-bis(3,5-ditert-butylphenyl)-N,N-dimethyl-4,5,6,7-tetrahydroiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocin-12-amine |
|---|---|
| PubChem CID | 175640382 |
| Molecular Formula | C47H60NO2P |
| Molecular Weight | 701.98 g/mol |
| Exact Mass | 701.44 |
| IUPAC Name | 1,10-bis(3,5-ditert-butylphenyl)-N,N-dimethyl-4,5,6,7-tetrahydroiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocin-12-amine |
| SMILES | CN(C)P1Oc2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)ccc3c2C2(CC3)CCc3ccc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c(c32)O1 |
| InChI | InChI=1S/C47H60NO2P/c1-43(2,3)33-23-31(24-34(27-33)44(4,5)6)37-17-15-29-19-21-47-22-20-30-16-18-38(32-25-35(45(7,8)9)28-36(26-32)46(10,11)12)42(40(30)47)50-51(48(13)14)49-41(37)39(29)47/h15-18,23-28H,19-22H2,1-14H3 |
| InChIKey | RVCLZPPOXDEDDY-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.98 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|